(1-cyano-1-phenylpropyl) diethyl phosphate structure
|
Common Name | (1-cyano-1-phenylpropyl) diethyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 88151-73-9 | Molecular Weight | 297.28700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20NO4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-cyano-1-phenylpropyl) diethyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20NO4P |
|---|---|
| Molecular Weight | 297.28700 |
| Exact Mass | 297.11300 |
| PSA | 78.36000 |
| LogP | 4.01318 |
| InChIKey | JFURKXAWULOWNS-UHFFFAOYSA-N |
| SMILES | CCOP(=O)(OCC)OC(C#N)(CC)c1ccccc1 |
|
~84%
(1-cyano-1-phen... CAS#:88151-73-9 |
| Literature: Harusawa, Shinya; Yoneda, Ryuji; Kurihara, Takushi; Hamada, Yasumasa; Shioiri, Takayuki Chemical & Pharmaceutical Bulletin, 1983 , vol. 31, p. 2932 - 2935 |
|
~93%
(1-cyano-1-phen... CAS#:88151-73-9 |
| Literature: Kurihara, Takushi; Santo, Kazunori; Harusawa, Shinya; Yoneda, Ryuji Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 12 p. 4777 - 4788 |
|
~%
(1-cyano-1-phen... CAS#:88151-73-9 |
| Literature: Kurihara, Takushi; Santo, Kazunori; Harusawa, Shinya; Yoneda, Ryuji Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 12 p. 4777 - 4788 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| Phosphoric acid,1-cyano-1-phenylpropyl diethyl ester |
| 2-diethylphosphonooxy-2-phenylbutanenitrile |
| 1-cyano-1-phenylpropyl diethyl phosphate |