3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline
Modify Date: 2026-08-26 23:43:46
3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline structure
|
Common Name | 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline | ||
|---|---|---|---|---|
| CAS Number | 881663-50-9 | Molecular Weight | 204.31 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H20N2 |
|---|---|
| Molecular Weight | 204.31 |
| InChIKey | RDHCATYLRDYCKW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1CCc2ncc(N)cc2C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline? |
| A: CAS number of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline is 881663-50-9. |
| Q: What is the English name of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline? |
| A: The English name of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline is 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline. |
| Q: What is the InChIKey of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline? |
| A: InChIKey of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline is RDHCATYLRDYCKW-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline? |
| A: SMILES notation of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline is CC(C)(C)C1CCc2ncc(N)cc2C1. |
| Q: What is the molecular formula of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline? |
| A: Molecular formula of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline is C13H20N2. |
| Q: What is the molecular weight of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline? |
| A: Molecular weight of 3-Amino-6-tert-butyl-5,6,7,8-tetrahydroquinoline is 204.31. |
| Q: What is the Chinese name of 881663-50-9? |
| A: Chinese name of 881663-50-9 is 881663-50-9. |