2-ethylhexyl 3-(4-bromophenyl)sulfanylpropanoate structure
|
Common Name | 2-ethylhexyl 3-(4-bromophenyl)sulfanylpropanoate | ||
|---|---|---|---|---|
| CAS Number | 881664-08-0 | Molecular Weight | 373.34800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H25BrO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-ethylhexyl 3-(4-bromophenyl)sulfanylpropanoate |
|---|
| Molecular Formula | C17H25BrO2S |
|---|---|
| Molecular Weight | 373.34800 |
| Exact Mass | 372.07600 |
| PSA | 51.60000 |
| LogP | 5.69090 |
| InChIKey | JTUXHRXCSSYALW-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)COC(=O)CCSc1ccc(Br)cc1 |
|
~91%
2-ethylhexyl 3-... CAS#:881664-08-0 |
| Literature: Itoh, Takahiro; Mase, Toshiaki Journal of Organic Chemistry, 2006 , vol. 71, # 5 p. 2203 - 2206 |
|
~88%
2-ethylhexyl 3-... CAS#:881664-08-0 |
| Literature: Itoh, Takahiro; Mase, Toshiaki Journal of Organic Chemistry, 2006 , vol. 71, # 5 p. 2203 - 2206 |