1,6-bis(4-ethoxyphenyl)hexane-1,6-dione structure
|
Common Name | 1,6-bis(4-ethoxyphenyl)hexane-1,6-dione | ||
|---|---|---|---|---|
| CAS Number | 88167-05-9 | Molecular Weight | 354.43900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,6-bis(4-ethoxyphenyl)hexane-1,6-dione |
|---|
| Molecular Formula | C22H26O4 |
|---|---|
| Molecular Weight | 354.43900 |
| Exact Mass | 354.18300 |
| PSA | 52.60000 |
| LogP | 5.11000 |
| InChIKey | DMJVWMWJDPJGKG-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(C(=O)CCCCC(=O)c2ccc(OCC)cc2)cc1 |
|
~%
1,6-bis(4-ethox... CAS#:88167-05-9 |
| Literature: van der Zanden Recueil des Travaux Chimiques des Pays-Bas, 1943 , vol. 62, p. 283,287 |
|
~%
1,6-bis(4-ethox... CAS#:88167-05-9 |
| Literature: Plant; Tomlinson Journal of the Chemical Society, 1935 , p. 1092 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |