nitro 2-methylprop-2-eneperoxoate
Modify Date: 2025-08-26 20:13:48
nitro 2-methylprop-2-eneperoxoate structure
|
Common Name | nitro 2-methylprop-2-eneperoxoate | ||
|---|---|---|---|---|
| CAS Number | 88181-75-3 | Molecular Weight | 147.08600 | |
| Density | 1.312g/cm3 | Boiling Point | 190.5ºC at 760 mmHg | |
| Molecular Formula | C4H5NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 91ºC | |
| Name | nitro 2-methylprop-2-eneperoxoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 190.5ºC at 760 mmHg |
| Molecular Formula | C4H5NO5 |
| Molecular Weight | 147.08600 |
| Flash Point | 91ºC |
| Exact Mass | 147.01700 |
| PSA | 81.35000 |
| LogP | 0.75220 |
| Index of Refraction | 1.442 |
| InChIKey | LLZWPQFQEBKRLX-UHFFFAOYSA-N |
| SMILES | C=C(C)C(=O)OO[N+](=O)[O-] |
|
~%
nitro 2-methylp... CAS#:88181-75-3 |
| Literature: Hasson, Alam S.; Tyndall, Geoffrey S.; Orlando, John J.; Singh, Sukhdeep; Hernandez, Samuel Q.; Campbell, Sean; Ibarra, Yesenia Journal of Physical Chemistry A, 2012 , vol. 116, # 24 p. 6264 - 6281 |
|
~%
nitro 2-methylp... CAS#:88181-75-3 |
| Literature: Canosa-Mas; King; Shallcross; Wayne Physical Chemistry Chemical Physics, 1999 , vol. 1, # 10 p. 2411 - 2414 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
CAS#:50-00-0
CAS#:116-09-6| peroxymethacrylic nitric anhydride |
| Peroxide,2-methyl-1-oxo-2-propenyl nitro |
| 2-Methyl-2-propenoyl nitro peroxide |
| peroxymethacryloyl nitrate |