4,10-Longipinanedione
Modify Date: 2026-08-21 21:02:38
4,10-Longipinanedione structure
|
Common Name | 4,10-Longipinanedione | ||
|---|---|---|---|---|
| CAS Number | 88198-34-9 | Molecular Weight | 234.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4,10-Longipinanedione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H22O2 |
|---|---|
| Molecular Weight | 234.33 |
| InChIKey | PZYLIQGFDJFRCZ-UHFFFAOYSA-N |
| SMILES | CC1C(=O)CC2C3C1C2(C)CCC(=O)C3(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 4,10-Longipinanedione? |
| A: SMILES notation of 4,10-Longipinanedione is CC1C(=O)CC2C3C1C2(C)CCC(=O)C3(C)C. |
| Q: What is the InChIKey of 4,10-Longipinanedione? |
| A: InChIKey of 4,10-Longipinanedione is PZYLIQGFDJFRCZ-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 88198-34-9? |
| A: Chinese name of 88198-34-9 is 88198-34-9. |
| Q: What is the molecular formula of 4,10-Longipinanedione? |
| A: Molecular formula of 4,10-Longipinanedione is C15H22O2. |
| Q: What is the molecular weight of 4,10-Longipinanedione? |
| A: Molecular weight of 4,10-Longipinanedione is 234.33. |
| Q: What is the CAS number of 4,10-Longipinanedione? |
| A: CAS number of 4,10-Longipinanedione is 88198-34-9. |
| Q: What is the English name of 4,10-Longipinanedione? |
| A: The English name of 4,10-Longipinanedione is 4,10-Longipinanedione. |