Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride
Modify Date: 2026-06-29 14:12:07
Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride structure
|
Common Name | Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride | ||
|---|---|---|---|---|
| CAS Number | 88198-81-6 | Molecular Weight | 229.74 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H20ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H20ClNO |
|---|---|
| Molecular Weight | 229.74 |
| InChIKey | OWLQZEDDFGYCHX-UHFFFAOYSA-M |
| SMILES | C[N+](C)(C)CC(C1=CC=CC=C1)OC.[Cl-] |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Toxicity against brine shrimp assessed as impaired swimming movements after 24 hrs
Source: ChEMBL
Target: Artemia
External Id: CHEMBL997285
|
Total 1, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride? |
| A: Molecular formula of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride is C12H20ClNO. |
| Q: What is the Chinese name of 88198-81-6? |
| A: Chinese name of 88198-81-6 is 88198-81-6. |
| Q: What is the CAS number of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride? |
| A: CAS number of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride is 88198-81-6. |
| Q: What is the molecular weight of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride? |
| A: Molecular weight of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride is 229.74. |
| Q: What is the English name of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride? |
| A: The English name of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride is Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride. |
| Q: What is the InChIKey of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride? |
| A: InChIKey of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride is OWLQZEDDFGYCHX-UHFFFAOYSA-M. |
| Q: What is the SMILES notation of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride? |
| A: SMILES notation of Benzeneethanaminium, beta-methoxy-N,N,N-trimethyl-, chloride is C[N+](C)(C)CC(C1=CC=CC=C1)OC.[Cl-]. |