6-(3,5-dimethylanilino)-3-methyl-1H-pyrimidine-2,4-dione structure
|
Common Name | 6-(3,5-dimethylanilino)-3-methyl-1H-pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 88200-81-1 | Molecular Weight | 245.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(3,5-dimethylanilino)-3-methyl-1H-pyrimidine-2,4-dione |
|---|
| Molecular Formula | C13H15N3O2 |
|---|---|
| Molecular Weight | 245.27700 |
| Exact Mass | 245.11600 |
| PSA | 67.15000 |
| LogP | 1.91930 |
| InChIKey | HVWYWBXVTFXQOY-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(Nc2cc(=O)n(C)c(=O)[nH]2)c1 |
|
~67%
6-(3,5-dimethyl... CAS#:88200-81-1 |
| Literature: Kurreck, H.; Bock, M.; Bretz, N.; Elsner, M.; Kraus, H.; et al. Journal of the American Chemical Society, 1984 , vol. 106, # 3 p. 737 - 746 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |