8-methoxy-5H-benzo[b]carbazole-6,11-dione structure
|
Common Name | 8-methoxy-5H-benzo[b]carbazole-6,11-dione | ||
|---|---|---|---|---|
| CAS Number | 88207-16-3 | Molecular Weight | 277.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-methoxy-5H-benzo[b]carbazole-6,11-dione |
|---|
| Molecular Formula | C17H11NO3 |
|---|---|
| Molecular Weight | 277.27400 |
| Exact Mass | 277.07400 |
| PSA | 59.16000 |
| LogP | 2.95190 |
| InChIKey | PTABQDXCOJMEBR-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)C(=O)c1[nH]c3ccccc3c1C2=O |
|
~22%
8-methoxy-5H-be... CAS#:88207-16-3 |
| Literature: Fernandez, Marcos Synthesis, 2009 , # 18 p. 3051 - 3060 |
|
~%
8-methoxy-5H-be... CAS#:88207-16-3 |
| Literature: Ashcroft, William R.; Dalton, Lesley; Beal, Michael G.; Humphrey, Godfred L.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2409 - 2412 |
|
~%
8-methoxy-5H-be... CAS#:88207-16-3 |
| Literature: Bucherer; Hayashi Journal fuer Praktische Chemie (Leipzig), 1932 , vol. <2> 132, p. 302,311, 312, 314 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |