8-nitroindolo[1,2-b]isoquinoline-6,12-dione structure
|
Common Name | 8-nitroindolo[1,2-b]isoquinoline-6,12-dione | ||
|---|---|---|---|---|
| CAS Number | 88207-30-1 | Molecular Weight | 292.24600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-nitroindolo[1,2-b]isoquinoline-6,12-dione |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H8N2O4 |
|---|---|
| Molecular Weight | 292.24600 |
| Exact Mass | 292.04800 |
| PSA | 84.89000 |
| LogP | 2.96650 |
| InChIKey | KQLFXJHPBGOPKY-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2-n2c1cc1ccc([N+](=O)[O-])cc1c2=O |
|
~%
8-nitroindolo[1... CAS#:88207-30-1 |
| Literature: Humphrey, Godfred L.; Dalton, Lesley; Joule, John A.; Scopes, David I.C. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2413 - 2416 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 8-nitroindolo<1,2-b>isoquinoline-6,12-dione |