1-(benzenesulfonyl)-2-(2-nitrophenyl)indole structure
|
Common Name | 1-(benzenesulfonyl)-2-(2-nitrophenyl)indole | ||
|---|---|---|---|---|
| CAS Number | 88207-42-5 | Molecular Weight | 378.40100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(benzenesulfonyl)-2-(2-nitrophenyl)indole |
|---|
| Molecular Formula | C20H14N2O4S |
|---|---|
| Molecular Weight | 378.40100 |
| Exact Mass | 378.06700 |
| PSA | 93.27000 |
| LogP | 6.05750 |
| InChIKey | XCNGLUNTOGJIJD-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1-c1cc2ccccc2n1S(=O)(=O)c1ccccc1 |
|
~%
1-(benzenesulfo... CAS#:88207-42-5 |
| Literature: Dalton, Lesley; Humphrey, Godfred L.; Cooper, Melanie M.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2417 - 2422 |