2-[1-(benzenesulfonyl)-3-chloroindol-2-yl]aniline structure
|
Common Name | 2-[1-(benzenesulfonyl)-3-chloroindol-2-yl]aniline | ||
|---|---|---|---|---|
| CAS Number | 88207-49-2 | Molecular Weight | 382.86300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H15ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[1-(benzenesulfonyl)-3-chloroindol-2-yl]aniline |
|---|
| Molecular Formula | C20H15ClN2O2S |
|---|---|
| Molecular Weight | 382.86300 |
| Exact Mass | 382.05400 |
| PSA | 73.47000 |
| LogP | 6.44290 |
| InChIKey | NJUUMXKGSCUTBH-UHFFFAOYSA-N |
| SMILES | Nc1ccccc1-c1c(Cl)c2ccccc2n1S(=O)(=O)c1ccccc1 |
|
~%
2-[1-(benzenesu... CAS#:88207-49-2 |
| Literature: Dalton, Lesley; Humphrey, Godfred L.; Cooper, Melanie M.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2417 - 2422 |
|
~%
2-[1-(benzenesu... CAS#:88207-49-2 |
| Literature: Dalton, Lesley; Humphrey, Godfred L.; Cooper, Melanie M.; Joule, John A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2417 - 2422 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |