2,5-dimethoxy-1-methyl-3-(trityloxymethyl)benzene structure
|
Common Name | 2,5-dimethoxy-1-methyl-3-(trityloxymethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 88208-72-4 | Molecular Weight | 424.53100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C29H28O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,5-dimethoxy-1-methyl-3-(trityloxymethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C29H28O3 |
|---|---|
| Molecular Weight | 424.53100 |
| Exact Mass | 424.20400 |
| PSA | 27.69000 |
| LogP | 6.52090 |
| InChIKey | CHVCEXIEMNIVMX-UHFFFAOYSA-N |
| SMILES | COc1cc(C)c(OC)c(COC(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
|
~%
2,5-dimethoxy-1... CAS#:88208-72-4 |
| Literature: Giles, Robin G. F.; Mitchell, Peter R. K.; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2147 - 2152 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,5-dimethoxy-3-methylbenzyl triphenylmethyl ether |