methyl 1,4,8-trimethoxy-2-methylphenanthrene-3-carboxylate structure
|
Common Name | methyl 1,4,8-trimethoxy-2-methylphenanthrene-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 88208-83-7 | Molecular Weight | 340.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 1,4,8-trimethoxy-2-methylphenanthrene-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C20H20O5 |
|---|---|
| Molecular Weight | 340.37000 |
| Exact Mass | 340.13100 |
| PSA | 53.99000 |
| LogP | 4.11380 |
| InChIKey | SLXRKAYNZSXMIW-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(C)c(OC)c2ccc3c(OC)cccc3c2c1OC |
|
~44%
methyl 1,4,8-tr... CAS#:88208-83-7 |
| Literature: Giles, Robin G. F.; Mitchell, Peter R. K.; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2147 - 2152 |
| 3-Phenanthrenecarboxylic acid,1,4,8-trimethoxy-2-methyl-,methyl ester |