4-(3-methoxy-2-methylphenoxy)-3-nitropyridine structure
|
Common Name | 4-(3-methoxy-2-methylphenoxy)-3-nitropyridine | ||
|---|---|---|---|---|
| CAS Number | 88220-09-1 | Molecular Weight | 260.24500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3-methoxy-2-methylphenoxy)-3-nitropyridine |
|---|
| Molecular Formula | C13H12N2O4 |
|---|---|
| Molecular Weight | 260.24500 |
| Exact Mass | 260.08000 |
| PSA | 77.17000 |
| LogP | 3.62230 |
| InChIKey | KCTNPTXQECOCMJ-UHFFFAOYSA-N |
| SMILES | COc1cccc(Oc2ccncc2[N+](=O)[O-])c1C |
|
~%
4-(3-methoxy-2-... CAS#:88220-09-1 |
| Literature: Moron, Jacqueline; Nguyen, Chi Hung; Bisagni, Emile Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 2 p. 225 - 229 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |