3-ethyl-4,7-dimethoxy-3H-2-benzofuran-1-one structure
|
Common Name | 3-ethyl-4,7-dimethoxy-3H-2-benzofuran-1-one | ||
|---|---|---|---|---|
| CAS Number | 88256-00-2 | Molecular Weight | 222.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-ethyl-4,7-dimethoxy-3H-2-benzofuran-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14O4 |
|---|---|
| Molecular Weight | 222.23700 |
| Exact Mass | 222.08900 |
| PSA | 44.76000 |
| LogP | 2.32530 |
| InChIKey | ILYMQASODXTSOY-UHFFFAOYSA-N |
| SMILES | CCC1OC(=O)c2c(OC)ccc(OC)c21 |
|
~%
3-ethyl-4,7-dim... CAS#:88256-00-2 |
| Literature: Anderson, John R.; Edwards, Raymond L.; Whalley, Anthony J. S. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2185 - 2192 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-ethyl-4,7-dimethoxyphtalide |