4-(Methylamino)-3-nitro-1,5-naphthyridin-2(1H)-one structure
|
Common Name | 4-(Methylamino)-3-nitro-1,5-naphthyridin-2(1H)-one | ||
|---|---|---|---|---|
| CAS Number | 882651-36-7 | Molecular Weight | 220.18500 | |
| Density | 1.49 | Boiling Point | 441.048ºC at 760 mmHg | |
| Molecular Formula | C9H8N4O3 | Melting Point | 275-277ºC | |
| MSDS | N/A | Flash Point | 220.538ºC | |
| Name | 4-(methylamino)-3-nitro-1H-1,5-naphthyridin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.49 |
|---|---|
| Boiling Point | 441.048ºC at 760 mmHg |
| Melting Point | 275-277ºC |
| Molecular Formula | C9H8N4O3 |
| Molecular Weight | 220.18500 |
| Flash Point | 220.538ºC |
| Exact Mass | 220.06000 |
| PSA | 103.86000 |
| LogP | 1.88150 |
| Index of Refraction | 1.653 |
| InChIKey | HHHNWCPUWBEQPU-UHFFFAOYSA-N |
| SMILES | CNc1c([N+](=O)[O-])c(=O)[nH]c2cccnc12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(methylamino)-3-nitro-1,5-naphthyridin-2(1h)-one |