(3-bromo-4-hydroxyphenyl)-(1-methyl-2-propylindolizin-3-yl)methanone structure
|
Common Name | (3-bromo-4-hydroxyphenyl)-(1-methyl-2-propylindolizin-3-yl)methanone | ||
|---|---|---|---|---|
| CAS Number | 88274-11-7 | Molecular Weight | 372.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H18BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (3-bromo-4-hydroxyphenyl)-(1-methyl-2-propylindolizin-3-yl)methanone |
|---|
| Molecular Formula | C19H18BrNO2 |
|---|---|
| Molecular Weight | 372.25600 |
| Exact Mass | 371.05200 |
| PSA | 41.71000 |
| LogP | 4.89930 |
| InChIKey | DLFHSCQGNVIKRH-UHFFFAOYSA-N |
| SMILES | CCCc1c(C)c2ccccn2c1C(=O)c1ccc(O)c(Br)c1 |
|
~%
(3-bromo-4-hydr... CAS#:88274-11-7 |
| Literature: Rosseels; Peiren; Cornil; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 339 - 346 |
|
~%
(3-bromo-4-hydr... CAS#:88274-11-7 |
| Literature: Rosseels; Peiren; Cornil; et al. European Journal of Medicinal Chemistry, 1983 , vol. 18, # 4 p. 339 - 346 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |