ethyl 2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propanoate structure
|
Common Name | ethyl 2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propanoate | ||
|---|---|---|---|---|
| CAS Number | 88281-81-6 | Molecular Weight | 289.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propanoate |
|---|
| Molecular Formula | C14H15N3O2S |
|---|---|
| Molecular Weight | 289.35300 |
| Exact Mass | 289.08800 |
| PSA | 91.82000 |
| LogP | 3.23400 |
| InChIKey | VLAZDXAPQZJOOX-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)=NNc1nc(-c2ccccc2)cs1 |
|
~%
ethyl 2-[(4-phe... CAS#:88281-81-6 |
| Literature: Dehuri, S. N.; Pradhan, P. C.; Nayak, A. Journal of the Indian Chemical Society, 1983 , vol. 60, p. 475 - 478 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |