7-Methoxy-2,2-dimethylchroman-5-ol
Modify Date: 2026-07-17 18:47:17
7-Methoxy-2,2-dimethylchroman-5-ol structure
|
Common Name | 7-Methoxy-2,2-dimethylchroman-5-ol | ||
|---|---|---|---|---|
| CAS Number | 883-75-0 | Molecular Weight | 208.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Methoxy-2,2-dimethylchroman-5-ol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16O3 |
|---|---|
| Molecular Weight | 208.25 |
| InChIKey | OJTVEOFVZUESBT-UHFFFAOYSA-N |
| SMILES | COc1cc(O)c2c(c1)OC(C)(C)CC2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 883-75-0? |
| A: Chinese name of 883-75-0 is 883-75-0. |
| Q: What is the molecular formula of 7-Methoxy-2,2-dimethylchroman-5-ol? |
| A: Molecular formula of 7-Methoxy-2,2-dimethylchroman-5-ol is C12H16O3. |
| Q: What is the SMILES notation of 7-Methoxy-2,2-dimethylchroman-5-ol? |
| A: SMILES notation of 7-Methoxy-2,2-dimethylchroman-5-ol is COc1cc(O)c2c(c1)OC(C)(C)CC2. |
| Q: What is the English name of 7-Methoxy-2,2-dimethylchroman-5-ol? |
| A: The English name of 7-Methoxy-2,2-dimethylchroman-5-ol is 7-Methoxy-2,2-dimethylchroman-5-ol. |
| Q: What is the CAS number of 7-Methoxy-2,2-dimethylchroman-5-ol? |
| A: CAS number of 7-Methoxy-2,2-dimethylchroman-5-ol is 883-75-0. |
| Q: What is the InChIKey of 7-Methoxy-2,2-dimethylchroman-5-ol? |
| A: InChIKey of 7-Methoxy-2,2-dimethylchroman-5-ol is OJTVEOFVZUESBT-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 7-Methoxy-2,2-dimethylchroman-5-ol? |
| A: Molecular weight of 7-Methoxy-2,2-dimethylchroman-5-ol is 208.25. |