3-Bromo-4-(trifluoromethoxy)benzenesulfonyl chloride structure
|
Common Name | 3-Bromo-4-(trifluoromethoxy)benzenesulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 883146-06-3 | Molecular Weight | 339.51400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H3BrClF3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-Bromo-4-(trifluoromethoxy)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H3BrClF3O3S |
|---|---|
| Molecular Weight | 339.51400 |
| Exact Mass | 337.86300 |
| PSA | 51.75000 |
| LogP | 4.35600 |
| InChIKey | VYGXKXBCLAWISQ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(OC(F)(F)F)c(Br)c1 |
| HS Code | 2909309090 |
|---|
|
~%
3-Bromo-4-(trif... CAS#:883146-06-3 |
| Literature: ABBOTT GMBH and CO. KG Patent: WO2006/40176 A1, 2006 ; Location in patent: Page/Page column 94 ; WO 2006/040176 A1 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3-bromo-4-trifluoromethanesulfonyloxy-5-trimethylsilanylbenzoic acid methyl ester |
| 3-bromo-4-thiocyanatophenol |
| Thiocyanic acid,2-bromo-4-hydroxyphenyl ester |
| 3-bromo-4-trifluoromethoxy-benzenesulfonyl chloride |