N-[1-(4-methoxyphenyl)heptan-3-yloxy]-N-methylmethanamine structure
|
Common Name | N-[1-(4-methoxyphenyl)heptan-3-yloxy]-N-methylmethanamine | ||
|---|---|---|---|---|
| CAS Number | 88330-50-1 | Molecular Weight | 265.39100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H27NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[1-(4-methoxyphenyl)heptan-3-yloxy]-N-methylmethanamine |
|---|
| Molecular Formula | C16H27NO2 |
|---|---|
| Molecular Weight | 265.39100 |
| Exact Mass | 265.20400 |
| PSA | 21.70000 |
| LogP | 3.67980 |
| InChIKey | YCUAKMIZKZWMKG-UHFFFAOYSA-N |
| SMILES | CCCCC(CCc1ccc(OC)cc1)ON(C)C |
|
~34%
N-[1-(4-methoxy... CAS#:88330-50-1 |
| Literature: Liguori, Angelo; Sindona, Giovanni; Uccella, Nicola Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1207 - 1215 |
|
~%
N-[1-(4-methoxy... CAS#:88330-50-1 |
| Literature: Liguori, Angelo; Sindona, Giovanni; Uccella, Nicola Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1207 - 1215 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |