ethyl 2-(4-oxo-[1,2,4]triazino[3,4-a]phthalazin-3-yl)acetate structure
|
Common Name | ethyl 2-(4-oxo-[1,2,4]triazino[3,4-a]phthalazin-3-yl)acetate | ||
|---|---|---|---|---|
| CAS Number | 88330-70-5 | Molecular Weight | 284.27000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-(4-oxo-[1,2,4]triazino[3,4-a]phthalazin-3-yl)acetate |
|---|
| Molecular Formula | C14H12N4O3 |
|---|---|
| Molecular Weight | 284.27000 |
| Exact Mass | 284.09100 |
| PSA | 86.45000 |
| LogP | 0.74330 |
| InChIKey | OLIRAXZFFOYFGG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1nnc2c3ccccc3cnn2c1=O |
|
~63%
ethyl 2-(4-oxo-... CAS#:88330-70-5 |
| Literature: Amer; Zimmer Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 5 p. 1231 - 1238 |
|
~0%
ethyl 2-(4-oxo-... CAS#:88330-70-5 |
| Literature: Amer; Zimmer Journal of Heterocyclic Chemistry, 1983 , vol. 20, # 5 p. 1231 - 1238 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |