1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene
1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene structure
|
Common Name | 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 88357-15-7 | Molecular Weight | 285.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H15NO2S |
|---|---|
| Molecular Weight | 285.36100 |
| Exact Mass | 285.08200 |
| PSA | 71.12000 |
| LogP | 5.13960 |
| InChIKey | YOTYSDWQVOUYEA-UHFFFAOYSA-N |
| SMILES | CC(=Cc1ccc(SCc2ccccc2)cc1)[N+](=O)[O-] |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: SMILES notation of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is CC(=Cc1ccc(SCc2ccccc2)cc1)[N+](=O)[O-]. |
| Q: What is the Chinese name of 88357-15-7? |
| A: Chinese name of 88357-15-7 is 88357-15-7. |
| Q: What are the upstream materials of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: Related upstream materials(CAS) of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene: 79-24-3;78832-95-8. |
| Q: What is the LogP of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: LogP of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is 5.13960. |
| Q: What is the molecular weight of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: Molecular weight of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is 285.36100. |
| Q: What is the English name of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: The English name of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene. |
| Q: What is the InChIKey of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: InChIKey of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is YOTYSDWQVOUYEA-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: Molecular formula of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is C16H15NO2S. |
| Q: What is the polar surface area (PSA) of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: Polar surface area (PSA) of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is 71.12000. |
| Q: What is the CAS number of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene? |
| A: CAS number of 1-benzylsulfanyl-4-(2-nitroprop-1-enyl)benzene is 88357-15-7. |