ethyl 3-methyl-7-propoxyocta-2,4-dienoate
ethyl 3-methyl-7-propoxyocta-2,4-dienoate structure
|
Common Name | ethyl 3-methyl-7-propoxyocta-2,4-dienoate | ||
|---|---|---|---|---|
| CAS Number | 88357-46-4 | Molecular Weight | 240.33900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | ethyl 3-methyl-7-propoxyocta-2,4-dienoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H24O3 |
|---|---|
| Molecular Weight | 240.33900 |
| Exact Mass | 240.17300 |
| PSA | 35.53000 |
| LogP | 3.25720 |
| InChIKey | HYKQWQUAKKYBMJ-UHFFFAOYSA-N |
| SMILES | CCCOC(C)CC=CC(C)=CC(=O)OCC |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
ethyl 3-methyl-... CAS#:88357-46-4 |
| Literature: Streinz, Ludvik; Romanuk, Miroslav Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 9 p. 2531 - 2535 |
|
~30%
ethyl 3-methyl-... CAS#:88357-46-4 |
| Literature: Streinz, Ludvik; Romanuk, Miroslav Collection of Czechoslovak Chemical Communications, 1983 , vol. 48, # 9 p. 2531 - 2535 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
CAS#:88357-47-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 3,7-dimethyl-8-oxa-2,4-undecadienoate |
| 2,4-Octadienoic acid,3-methyl-7-propoxy-,ethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: Polar surface area (PSA) of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is 35.53000. |
| Q: What is the Chinese name of 88357-46-4? |
| A: Chinese name of 88357-46-4 is 88357-46-4. |
| Q: What is the English name of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: The English name of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is ethyl 3-methyl-7-propoxyocta-2,4-dienoate. |
| Q: What are the upstream materials of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: Related upstream materials(CAS) of ethyl 3-methyl-7-propoxyocta-2,4-dienoate: 88357-48-6;88357-49-7;41891-54-7. |
| Q: What English synonyms does ethyl 3-methyl-7-propoxyocta-2,4-dienoate have? |
| A: English synonyms of ethyl 3-methyl-7-propoxyocta-2,4-dienoate: ethyl 3,7-dimethyl-8-oxa-2,4-undecadienoate, 2,4-Octadienoic acid,3-methyl-7-propoxy-,ethyl ester. |
| Q: What is the CAS number of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: CAS number of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is 88357-46-4. |
| Q: What is the molecular formula of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: Molecular formula of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is C14H24O3. |
| Q: What is the InChIKey of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: InChIKey of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is HYKQWQUAKKYBMJ-UHFFFAOYSA-N. |
| Q: What is the molecular weight of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: Molecular weight of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is 240.33900. |
| Q: What is the SMILES notation of ethyl 3-methyl-7-propoxyocta-2,4-dienoate? |
| A: SMILES notation of ethyl 3-methyl-7-propoxyocta-2,4-dienoate is CCCOC(C)CC=CC(C)=CC(=O)OCC. |