2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide
2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide structure
|
Common Name | 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 88369-73-7 | Molecular Weight | 337.80300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H16ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H16ClN3O |
|---|---|
| Molecular Weight | 337.80300 |
| Exact Mass | 337.09800 |
| PSA | 57.51000 |
| LogP | 5.05640 |
| InChIKey | BJSCCGQNYBADAZ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccnc1Cl)c1ccccc1NCc1ccccc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~64%
2-(benzylamino)... CAS#:88369-73-7 |
| Literature: Kovac, T.; Oklobdzija, M.; Comisso, G.; Decorte, E.; Fajdiga, T.; et al. Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1339 - 1349 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: Related upstream materials(CAS) of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide: 84446-17-3;100-46-9. |
| Q: What is the CAS number of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: CAS number of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is 88369-73-7. |
| Q: What is the polar surface area (PSA) of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: Polar surface area (PSA) of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is 57.51000. |
| Q: What is the molecular weight of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: Molecular weight of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is 337.80300. |
| Q: What is the molecular formula of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: Molecular formula of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is C19H16ClN3O. |
| Q: What is the InChIKey of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: InChIKey of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is BJSCCGQNYBADAZ-UHFFFAOYSA-N. |
| Q: What is the LogP of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: LogP of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is 5.05640. |
| Q: What is the SMILES notation of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: SMILES notation of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is O=C(Nc1cccnc1Cl)c1ccccc1NCc1ccccc1. |
| Q: What is the Chinese name of 88369-73-7? |
| A: Chinese name of 88369-73-7 is 88369-73-7. |
| Q: What is the English name of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide? |
| A: The English name of 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide is 2-(benzylamino)-N-(2-chloropyridin-3-yl)benzamide. |