methyl 4-(3-ethyl-3-hydroxymethyltriazen-1-yl)benzoate structure
|
Common Name | methyl 4-(3-ethyl-3-hydroxymethyltriazen-1-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 88392-04-5 | Molecular Weight | 237.25500 | |
| Density | 1.18g/cm3 | Boiling Point | 362.1ºC at 760 mmHg | |
| Molecular Formula | C11H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 4-[[ethyl(hydroxymethyl)amino]diazenyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 362.1ºC at 760 mmHg |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.25500 |
| Exact Mass | 237.11100 |
| PSA | 74.49000 |
| LogP | 1.74360 |
| Index of Refraction | 1.545 |
| InChIKey | KWHQXDKHEDLOSK-UHFFFAOYSA-N |
| SMILES | CCN(CO)N=Nc1ccc(C(=O)OC)cc1 |
| HS Code | 2918199090 |
|---|
|
~%
methyl 4-(3-eth... CAS#:88392-04-5 |
| Literature: Vaughan; Tang; Llanos; Horton; Simmonds; Hickman; Stevens Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 357 - 363 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| Nehtyb |