N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine
N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine structure
|
Common Name | N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine | ||
|---|---|---|---|---|
| CAS Number | 884-92-4 | Molecular Weight | 265.35300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H24NO2PS |
|---|---|
| Molecular Weight | 265.35300 |
| Exact Mass | 265.12700 |
| PSA | 72.39000 |
| LogP | 4.49530 |
| InChIKey | ZSNNODRPHFZZOO-UHFFFAOYSA-N |
| SMILES | CCCCCCNP1(=S)OCC(C)(C)CO1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
N-hexyl-5,5-dim... CAS#:884-92-4 |
| Literature: Edmundson,R.S. Tetrahedron, 1964 , vol. 20, p. 2781 - 2795 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,3,2-Dioxaphosphorinan-2-amine,N-hexyl-5,5-dimethyl-,2-sulfide |
| 5,5-Dimethyl-2-thioxo-2-hexylamino-1,3,2-dioxaphosphorinan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: SMILES notation of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is CCCCCCNP1(=S)OCC(C)(C)CO1. |
| Q: What is the Chinese name of 884-92-4? |
| A: Chinese name of 884-92-4 is 884-92-4. |
| Q: What are the upstream materials of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Related upstream materials(CAS) of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine: 873-98-3;111-26-2. |
| Q: What English synonyms does N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine have? |
| A: English synonyms of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine: 1,3,2-Dioxaphosphorinan-2-amine,N-hexyl-5,5-dimethyl-,2-sulfide, 5,5-Dimethyl-2-thioxo-2-hexylamino-1,3,2-dioxaphosphorinan. |
| Q: What is the LogP of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: LogP of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is 4.49530. |
| Q: What is the molecular weight of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Molecular weight of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is 265.35300. |
| Q: What is the molecular formula of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: Molecular formula of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is C11H24NO2PS. |
| Q: What is the InChIKey of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: InChIKey of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is ZSNNODRPHFZZOO-UHFFFAOYSA-N. |
| Q: What is the English name of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: The English name of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine. |
| Q: What is the CAS number of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine? |
| A: CAS number of N-hexyl-5,5-dimethyl-2-sulfanylidene-1,3,2λ5-dioxaphosphinan-2-amine is 884-92-4. |