dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]indeno[1,2-b][1,4]dithiine-2,3-dicarboxylate
Modify Date: 2025-09-19 01:24:50
![dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]indeno[1,2-b][1,4]dithiine-2,3-dicarboxylate Structure](https://image.chemsrc.com/caspic/077/88430-84-6.png)
dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]indeno[1,2-b][1,4]dithiine-2,3-dicarboxylate structure
|
Common Name | dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]indeno[1,2-b][1,4]dithiine-2,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 88430-84-6 | Molecular Weight | 536.61800 | |
| Density | 1.6g/cm3 | Boiling Point | 578.6ºC at 760 mmHg | |
| Molecular Formula | C22H16O8S4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.9ºC | |
| Name | dimethyl 9-[4,5-bis(methoxycarbonyl)-1,3-dithiol-2-ylidene]indeno[1,2-b][1,4]dithiine-2,3-dicarboxylate |
|---|
| Density | 1.6g/cm3 |
|---|---|
| Boiling Point | 578.6ºC at 760 mmHg |
| Molecular Formula | C22H16O8S4 |
| Molecular Weight | 536.61800 |
| Flash Point | 284.9ºC |
| Exact Mass | 535.97300 |
| PSA | 206.40000 |
| LogP | 4.11260 |
| Index of Refraction | 1.721 |
| InChIKey | MQXOUPHJPDZDOP-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=O)OC)SC(=C2C3=C(SC(C(=O)OC)=C(C(=O)OC)S3)c3ccccc32)S1 |
|
~78%
dimethyl 9-[4,5... CAS#:88430-84-6 |
| Literature: Lakshmikantham, M. V.; Cava, Michael P.; Carroll, Patrick J. Journal of Organic Chemistry, 1984 , vol. 49, # 4 p. 726 - 728 |
