N,N-diethyl-2-methoxy-6-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide structure
|
Common Name | N,N-diethyl-2-methoxy-6-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 88431-01-0 | Molecular Weight | 355.42800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-diethyl-2-methoxy-6-[2-(4-methoxyphenyl)-2-oxoethyl]benzamide |
|---|
| Molecular Formula | C21H25NO4 |
|---|---|
| Molecular Weight | 355.42800 |
| Exact Mass | 355.17800 |
| PSA | 55.84000 |
| LogP | 3.61120 |
| InChIKey | VMIAFWLRGWUMNX-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)c1c(CC(=O)c2ccc(OC)cc2)cccc1OC |
|
~%
N,N-diethyl-2-m... CAS#:88431-01-0 |
| Literature: Watanabe, Mitsuaki; Sahara, Masanori; Kubo, Masaki; Furukawa, Sunao; Billedeau, R. J.; Snieckus, V. Journal of Organic Chemistry, 1984 , vol. 49, # 5 p. 742 - 747 |
|
~%
N,N-diethyl-2-m... CAS#:88431-01-0 |
| Literature: Watanabe, Mitsuaki; Sahara, Masanori; Kubo, Masaki; Furukawa, Sunao; Billedeau, R. J.; Snieckus, V. Journal of Organic Chemistry, 1984 , vol. 49, # 5 p. 742 - 747 |