2-(1,4-dioxospiro[4.5]decan-10-yl)ethyl 2,2,2-trifluoroacetate structure
|
Common Name | 2-(1,4-dioxospiro[4.5]decan-10-yl)ethyl 2,2,2-trifluoroacetate | ||
|---|---|---|---|---|
| CAS Number | 88441-41-2 | Molecular Weight | 306.27800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H17F3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(1,4-dioxospiro[4.5]decan-10-yl)ethyl 2,2,2-trifluoroacetate |
|---|
| Molecular Formula | C14H17F3O4 |
|---|---|
| Molecular Weight | 306.27800 |
| Exact Mass | 306.10800 |
| PSA | 60.44000 |
| LogP | 2.59060 |
| InChIKey | BJWWSDJARWHNLY-UHFFFAOYSA-N |
| SMILES | O=C(OCCC1CCCCC12C(=O)CCC2=O)C(F)(F)F |
|
~%
2-(1,4-dioxospi... CAS#:88441-41-2 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
|
~%
2-(1,4-dioxospi... CAS#:88441-41-2 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
|
~%
2-(1,4-dioxospi... CAS#:88441-41-2 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |