3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)benzoic acid
Modify Date: 2025-08-27 10:50:04
3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)benzoic acid structure
|
Common Name | 3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 884497-56-7 | Molecular Weight | 267.32200 | |
| Density | 1.221g/cm3 | Boiling Point | 485.9ºC at 760 mmHg | |
| Molecular Formula | C17H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 247.7ºC | |
| Name | 3-(5,6-dimethyl-1,3-dihydroisoindol-2-yl)benzoic acid |
|---|
| Density | 1.221g/cm3 |
|---|---|
| Boiling Point | 485.9ºC at 760 mmHg |
| Molecular Formula | C17H17NO2 |
| Molecular Weight | 267.32200 |
| Flash Point | 247.7ºC |
| Exact Mass | 267.12600 |
| PSA | 40.54000 |
| LogP | 3.58680 |
| Index of Refraction | 1.635 |
| InChIKey | FAGPZTWSFDKCIQ-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1C)CN(c1cccc(C(=O)O)c1)C2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |