3',4'-DIFLUORO-3-(1,3-DIOXAN-2-YL)-PROPIOPHENONE structure
|
Common Name | 3',4'-DIFLUORO-3-(1,3-DIOXAN-2-YL)-PROPIOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 884504-28-3 | Molecular Weight | 256.24500 | |
| Density | 1.217g/cm3 | Boiling Point | 359.9ºC at 760 mmHg | |
| Molecular Formula | C13H14F2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.7ºC | |
| Name | 1-(3,4-difluorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.217g/cm3 |
|---|---|
| Boiling Point | 359.9ºC at 760 mmHg |
| Molecular Formula | C13H14F2O3 |
| Molecular Weight | 256.24500 |
| Flash Point | 165.7ºC |
| Exact Mass | 256.09100 |
| PSA | 35.53000 |
| LogP | 2.69070 |
| Index of Refraction | 1.487 |
| InChIKey | WZYPVXLPRGTFTG-UHFFFAOYSA-N |
| SMILES | O=C(CCC1OCCCO1)c1ccc(F)c(F)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3',4'-difluoro-3-(1,3-dioxan-2-yl)propiophenone |