2',5'-DIMETHOXY-3-(1,3-DIOXAN-2-YL)PROPIOPHENONE structure
|
Common Name | 2',5'-DIMETHOXY-3-(1,3-DIOXAN-2-YL)PROPIOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 884504-42-1 | Molecular Weight | 280.31600 | |
| Density | 1.121g/cm3 | Boiling Point | 412.5ºC at 760 mmHg | |
| Molecular Formula | C15H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.3ºC | |
| Name | 1-(2,5-dimethoxyphenyl)-3-(1,3-dioxan-2-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.121g/cm3 |
|---|---|
| Boiling Point | 412.5ºC at 760 mmHg |
| Molecular Formula | C15H20O5 |
| Molecular Weight | 280.31600 |
| Flash Point | 182.3ºC |
| Exact Mass | 280.13100 |
| PSA | 53.99000 |
| LogP | 2.42970 |
| Index of Refraction | 1.503 |
| InChIKey | ICBQYSPWSVLILU-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C(=O)CCC2OCCCO2)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2',5'-Dimethoxy-3-(1,3-Dioxan-2-Yl)Propiophenone |