2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine
![2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine Structure](https://image.chemsrc.com/caspic/260/88467-87-2.png)
2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine structure
|
Common Name | 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine | ||
|---|---|---|---|---|
| CAS Number | 88467-87-2 | Molecular Weight | 238.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2-(2-Methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine, CAS号88467-87-2, molecular formula C15H14N2O, molecular weight 238.28400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H14N2O |
|---|---|
| Molecular Weight | 238.28400 |
| Exact Mass | 238.11100 |
| PSA | 26.53000 |
| LogP | 3.31830 |
| InChIKey | TURNJZHDTBEFFY-UHFFFAOYSA-N |
| SMILES | COc1ccc(C)cc1-c1cc2ccccn2n1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~60%
2-(2-methoxy-5-... CAS#:88467-87-2 |
| Literature: Gunzenhauser, Sigmund; Balli, Heinz Helvetica Chimica Acta, 1985 , vol. 68, p. 56 - 63 |
|
~%
2-(2-methoxy-5-... CAS#:88467-87-2 |
| Literature: Gunzenhauser, Sigmund; Balli, Heinz Helvetica Chimica Acta, 1985 , vol. 68, p. 56 - 63 |
|
~%
2-(2-methoxy-5-... CAS#:88467-87-2 |
| Literature: Gunzenhauser, Sigmund; Balli, Heinz Helvetica Chimica Acta, 1985 , vol. 68, p. 56 - 63 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 1 | |
![4-methyl-6-(1H-pyrazolo[1,5-a]pyridin-2-ylidene)cyclohexa-2,4-dien-1-one structure](https://image.chemsrc.com/caspic/336/88467-85-0.png)
CAS#:88467-85-0This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the upstream materials of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: Related upstream materials(CAS) of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine: 88467-86-1;109-06-8;63113-79-1. |
| Q: What is the polar surface area (PSA) of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: Polar surface area (PSA) of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is 26.53000. |
| Q: What is the molecular formula of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: Molecular formula of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is C15H14N2O. |
| Q: What is the Chinese name of 88467-87-2? |
| A: Chinese name of 88467-87-2 is 88467-87-2. |
| Q: What is the LogP of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: LogP of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is 3.31830. |
| Q: What is the molecular weight of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: Molecular weight of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is 238.28400. |
| Q: What is the CAS number of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: CAS number of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is 88467-87-2. |
| Q: What is the InChIKey of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: InChIKey of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is TURNJZHDTBEFFY-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: Related downstream products(CAS) of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine: 88467-85-0. |
| Q: What is the SMILES notation of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine? |
| A: SMILES notation of 2-(2-methoxy-5-methylphenyl)pyrazolo[1,5-a]pyridine is COc1ccc(C)cc1-c1cc2ccccn2n1. |