(1-bromo-2-methylbutan-2-yl) N-cyclohexylcarbamate structure
|
Common Name | (1-bromo-2-methylbutan-2-yl) N-cyclohexylcarbamate | ||
|---|---|---|---|---|
| CAS Number | 88476-28-2 | Molecular Weight | 292.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22BrNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1-bromo-2-methylbutan-2-yl) N-cyclohexylcarbamate |
|---|
| Molecular Formula | C12H22BrNO2 |
|---|---|
| Molecular Weight | 292.21300 |
| Exact Mass | 291.08300 |
| PSA | 41.82000 |
| LogP | 3.81330 |
| InChIKey | QAIWUFRSNRYCAA-UHFFFAOYSA-N |
| SMILES | CCC(C)(CBr)OC(=O)NC1CCCCC1 |
|
~62%
(1-bromo-2-meth... CAS#:88476-28-2 |
| Literature: Carpino, Louis A.; Rice, Norman W.; Mansour, E. M. E.; Triolo, Salvatore A. Journal of Organic Chemistry, 1984 , vol. 49, # 5 p. 836 - 842 |
|
~%
(1-bromo-2-meth... CAS#:88476-28-2 |
| Literature: Carpino, Louis A.; Rice, Norman W.; Mansour, E. M. E.; Triolo, Salvatore A. Journal of Organic Chemistry, 1984 , vol. 49, # 5 p. 836 - 842 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |