3-(bromomethyl)pentan-3-ol,phenylcarbamic acid structure
|
Common Name | 3-(bromomethyl)pentan-3-ol,phenylcarbamic acid | ||
|---|---|---|---|---|
| CAS Number | 88476-33-9 | Molecular Weight | 318.20700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H20BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-(bromomethyl)pentan-3-ol,phenylcarbamic acid |
|---|
| Molecular Formula | C13H20BrNO3 |
|---|---|
| Molecular Weight | 318.20700 |
| Exact Mass | 317.06300 |
| PSA | 69.56000 |
| LogP | 3.78190 |
| InChIKey | BJNRZZKVSSVXBC-UHFFFAOYSA-N |
| SMILES | CCC(O)(CC)CBr.O=C(O)Nc1ccccc1 |
|
~48%
3-(bromomethyl)... CAS#:88476-33-9 |
| Literature: Carpino, Louis A.; Rice, Norman W.; Mansour, E. M. E.; Triolo, Salvatore A. Journal of Organic Chemistry, 1984 , vol. 49, # 5 p. 836 - 842 |
|
~%
3-(bromomethyl)... CAS#:88476-33-9 |
| Literature: Carpino, Louis A.; Rice, Norman W.; Mansour, E. M. E.; Triolo, Salvatore A. Journal of Organic Chemistry, 1984 , vol. 49, # 5 p. 836 - 842 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |