2-nitrooxypropyl 3-oxobutanoate structure
|
Common Name | 2-nitrooxypropyl 3-oxobutanoate | ||
|---|---|---|---|---|
| CAS Number | 88488-52-2 | Molecular Weight | 205.16500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H11NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-nitrooxypropyl 3-oxobutanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7H11NO6 |
|---|---|
| Molecular Weight | 205.16500 |
| Exact Mass | 205.05900 |
| PSA | 98.42000 |
| LogP | 0.62870 |
| InChIKey | FDFSXXRTKKNUQD-UHFFFAOYSA-N |
| SMILES | CC(=O)CC(=O)OCC(C)O[N+](=O)[O-] |
|
~85%
2-nitrooxypropy... CAS#:88488-52-2 |
| Literature: Ogawa; Nakazato; Tsuchida; Hatayama Chemical and Pharmaceutical Bulletin, 1993 , vol. 41, # 6 p. 1049 - 1054 |
|
~70%
2-nitrooxypropy... CAS#:88488-52-2 |
| Literature: Kobayashi; Inoue; Kita; Yoshiya; Nishino; Oizumi; Kimura Chemical and Pharmaceutical Bulletin, 1995 , vol. 43, # 5 p. 788 - 796 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-nitroxypropyl acetoacetate |
| 2-nitrooxypropyl acetoacetate |