2,4(1H,3H)-Pyrimidinedione,5-fluoro-6-(1,1,2,2,2-pentafluoroethyl)- structure
|
Common Name | 2,4(1H,3H)-Pyrimidinedione,5-fluoro-6-(1,1,2,2,2-pentafluoroethyl)- | ||
|---|---|---|---|---|
| CAS Number | 885-05-2 | Molecular Weight | 248.08300 | |
| Density | 1.71g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H2F6N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-fluoro-6-(1,1,2,2,2-pentafluoroethyl)-1H-pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.71g/cm3 |
|---|---|
| Molecular Formula | C6H2F6N2O2 |
| Molecular Weight | 248.08300 |
| Exact Mass | 248.00200 |
| PSA | 65.72000 |
| LogP | 0.85640 |
| Index of Refraction | 1.406 |
| InChIKey | OBUMIVDXVIZEQD-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(C(F)(F)C(F)(F)F)c(F)c(=O)[nH]1 |
|
~%
2,4(1H,3H)-Pyri... CAS#:885-05-2 |
| Literature: Bergmann et al. Journal of the Chemical Society, 1959 , p. 3278,3282 |
|
~%
2,4(1H,3H)-Pyri... CAS#:885-05-2 |
| Literature: Bergmann et al. Journal of the Chemical Society, 1959 , p. 3278,3282 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5-fluoro-6-pentafluoroethyl-1H-pyrimidine-2,4-dione |
| 5-Fluor-6-pentafluoraethyl-1H-pyrimidin-2,4-dion |