3,7-dichloro-9H-fluoren-2-amine structure
|
Common Name | 3,7-dichloro-9H-fluoren-2-amine | ||
|---|---|---|---|---|
| CAS Number | 885-47-2 | Molecular Weight | 250.12300 | |
| Density | 1.433g/cm3 | Boiling Point | 420.1ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.9ºC | |
| Name | 3,7-dichloro-9H-fluoren-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 420.1ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2N |
| Molecular Weight | 250.12300 |
| Flash Point | 207.9ºC |
| Exact Mass | 249.01100 |
| PSA | 26.02000 |
| LogP | 4.72800 |
| Index of Refraction | 1.705 |
| InChIKey | JUJFKCZWABNHHO-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1Cl)-c1ccc(Cl)cc1C2 |
|
~%
3,7-dichloro-9H... CAS#:885-47-2 |
| Literature: Sieglitz,A. Chemische Berichte, 1964 , vol. 97, p. 3392 - 3396 |
|
~%
3,7-dichloro-9H... CAS#:885-47-2 |
| Literature: Sieglitz,A. Chemische Berichte, 1964 , vol. 97, p. 3392 - 3396 |
|
~%
3,7-dichloro-9H... CAS#:885-47-2 |
| Literature: Bell; Gibson Journal of the Chemical Society, 1955 , p. 24,26 |
|
~%
3,7-dichloro-9H... CAS#:885-47-2 |
| Literature: Bell; Gibson Journal of the Chemical Society, 1955 , p. 24,26 |
| 3,7-Dichlor-2-amino-fluoren |
| HMS3088D24 |
| 3,7-dichloro-fluoren-2-ylamine |
| 3,7-Dichlor-fluoren-2-ylamin |