(2-sulfamoyl-1,3-benzothiazol-5-yl) butanoate
Modify Date: 2026-08-16 00:55:09
(2-sulfamoyl-1,3-benzothiazol-5-yl) butanoate structure
|
Common Name | (2-sulfamoyl-1,3-benzothiazol-5-yl) butanoate | ||
|---|---|---|---|---|
| CAS Number | 88515-17-7 | Molecular Weight | 300.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2-sulfamoyl-1,3-benzothiazol-5-yl) butanoate |
|---|
| Molecular Formula | C11H12N2O4S2 |
|---|---|
| Molecular Weight | 300.35400 |
| Exact Mass | 300.02400 |
| PSA | 135.97000 |
| LogP | 3.43030 |
| InChIKey | UAGGHDNCRWPRJM-UHFFFAOYSA-N |
| SMILES | CCCC(=O)Oc1ccc2sc(S(N)(=O)=O)nc2c1 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: In vitro inhibition of human Carbonic Anhydrase II
Source: ChEMBL
Target: Carbonic anhydrase 2
External Id: CHEMBL656574
|
|
Name: Change in intraocular pressure in Albino rabbit when 10% of compound suspension bilat...
Source: ChEMBL
Target: Oryctolagus cuniculus
External Id: CHEMBL772617
|
Total 2, Current Page 1 of 1
1