methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate
![methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate Structure](https://image.chemsrc.com/caspic/107/88515-89-3.png)
methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate structure
|
Common Name | methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate | ||
|---|---|---|---|---|
| CAS Number | 88515-89-3 | Molecular Weight | 282.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H18O6 |
|---|---|
| Molecular Weight | 282.28900 |
| Exact Mass | 282.11000 |
| PSA | 71.06000 |
| LogP | 1.57040 |
| InChIKey | LRWFQUMOLZVRSY-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOc1cccc(OCCC(=O)OC)c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
methyl 3-[3-(3-... CAS#:88515-89-3 |
| Literature: Simpson et al. Journal of the Chemical Society, 1951 , p. 2239,2243 |
|
~%
methyl 3-[3-(3-... CAS#:88515-89-3 |
| Literature: Simpson et al. Journal of the Chemical Society, 1951 , p. 2239,2243 |
|
~%
methyl 3-[3-(3-... CAS#:88515-89-3 |
| Literature: Simpson et al. Journal of the Chemical Society, 1951 , p. 2239,2243 |
![3-[3-(2-carboxyethoxy)phenoxy]propanoic acid structure](https://image.chemsrc.com/caspic/176/61479-41-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3,3'-m-Phenylendioxy-di-propionsaeure-dimethylester |
| 3,3'-m-phenylenedioxy-di-propionic acid dimethyl ester |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: Polar surface area (PSA) of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is 71.06000. |
| Q: What is the molecular weight of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: Molecular weight of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is 282.28900. |
| Q: What is the InChIKey of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: InChIKey of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is LRWFQUMOLZVRSY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: SMILES notation of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is COC(=O)CCOc1cccc(OCCC(=O)OC)c1. |
| Q: What is the molecular formula of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: Molecular formula of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is C14H18O6. |
| Q: What is the LogP of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: LogP of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is 1.57040. |
| Q: What English synonyms does methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate have? |
| A: English synonyms of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate: 3,3'-m-Phenylendioxy-di-propionsaeure-dimethylester, 3,3'-m-phenylenedioxy-di-propionic acid dimethyl ester. |
| Q: What is the CAS number of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: CAS number of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is 88515-89-3. |
| Q: What is the English name of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate? |
| A: The English name of methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate is methyl 3-[3-(3-methoxy-3-oxopropoxy)phenoxy]propanoate. |
| Q: What is the Chinese name of 88515-89-3? |
| A: Chinese name of 88515-89-3 is 88515-89-3. |