b-Alanine, N-(phenylmethoxy)-,phenylmethyl ester structure
|
Common Name | b-Alanine, N-(phenylmethoxy)-,phenylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 88517-41-3 | Molecular Weight | 285.33800 | |
| Density | 1.136g/cm3 | Boiling Point | 417.9ºC at 760mmHg | |
| Molecular Formula | C17H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.6ºC | |
| Name | benzyl 3-(phenylmethoxyamino)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.136g/cm3 |
|---|---|
| Boiling Point | 417.9ºC at 760mmHg |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.33800 |
| Flash Point | 206.6ºC |
| Exact Mass | 285.13600 |
| PSA | 47.56000 |
| LogP | 3.23220 |
| Index of Refraction | 1.56 |
| InChIKey | WPCRSBBJKWDNDY-UHFFFAOYSA-N |
| SMILES | O=C(CCNOCc1ccccc1)OCc1ccccc1 |
|
~43%
b-Alanine, N-(p... CAS#:88517-41-3 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
|
~64%
b-Alanine, N-(p... CAS#:88517-41-3 |
| Literature: Schobert, Rainer; Stangl, Andreas; Hannemann, Kerstin Tetrahedron, 2008 , vol. 64, # 8 p. 1711 - 1720 |
|
~%
b-Alanine, N-(p... CAS#:88517-41-3 |
| Literature: Ikeda; Achiwa; Sekiya Chemical and Pharmaceutical Bulletin, 1989 , vol. 37, # 5 p. 1179 - 1184 |
| b-Alanine,N-(phenylmethoxy)-,phenylmethyl ester |
| benzyl 3-(benzyloxyamino)propionate |