7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione
![7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione Structure](https://image.chemsrc.com/caspic/083/88521-52-2.png)
7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione structure
|
Common Name | 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione | ||
|---|---|---|---|---|
| CAS Number | 88521-52-2 | Molecular Weight | 274.27200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H14N2O4 |
|---|---|
| Molecular Weight | 274.27200 |
| Exact Mass | 274.09500 |
| PSA | 75.71000 |
| LogP | 0.44500 |
| InChIKey | UYUOEJPHGFNHNT-UHFFFAOYSA-N |
| SMILES | O=C1NC2(CCCO2)C(=O)N(Cc2ccccc2)C1=O |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![4'-benzyl-3-bromospiro[oxolane-2,2'-piperazine]-3',6'-dione structure](https://image.chemsrc.com/caspic/017/344873-93-4.png)
![diethyl 2-[(2-chloroacetyl)amino]pent-2-enedioate structure](https://image.chemsrc.com/caspic/269/88521-38-4.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4'-benzyl-spiro<oxolane-2,2'-piperazine>-3',5',6'-trione |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: CAS number of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is 88521-52-2. |
| Q: What is the Chinese name of 88521-52-2? |
| A: Chinese name of 88521-52-2 is 88521-52-2. |
| Q: What is the molecular formula of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: Molecular formula of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is C14H14N2O4. |
| Q: What English synonyms does 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione have? |
| A: English synonyms of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione: 4'-benzyl-spiro-3',5',6'-trione. |
| Q: What is the polar surface area (PSA) of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: Polar surface area (PSA) of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is 75.71000. |
| Q: What is the SMILES notation of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: SMILES notation of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is O=C1NC2(CCCO2)C(=O)N(Cc2ccccc2)C1=O. |
| Q: What is the InChIKey of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: InChIKey of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is UYUOEJPHGFNHNT-UHFFFAOYSA-N. |
| Q: What is the English name of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: The English name of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione. |
| Q: What are the upstream materials of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: Related upstream materials(CAS) of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione: 5965-53-7;344873-93-4;88521-40-8;88521-38-4;100-46-9. |
| Q: What is the LogP of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione? |
| A: LogP of 7-benzyl-1-oxa-7,10-diazaspiro[4.5]decane-6,8,9-trione is 0.44500. |