1-(2-hydroxy-5-nitrophenyl)-2-methylpropan-1-one structure
|
Common Name | 1-(2-hydroxy-5-nitrophenyl)-2-methylpropan-1-one | ||
|---|---|---|---|---|
| CAS Number | 88521-75-9 | Molecular Weight | 209.19900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-hydroxy-5-nitrophenyl)-2-methylpropan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H11NO4 |
|---|---|
| Molecular Weight | 209.19900 |
| Exact Mass | 209.06900 |
| PSA | 83.12000 |
| LogP | 2.66230 |
| InChIKey | RMEXNNGZBQYXPU-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)c1cc([N+](=O)[O-])ccc1O |
|
~22%
1-(2-hydroxy-5-... CAS#:88521-75-9 |
| Literature: Takeda Chemical Industries, Ltd. Patent: EP1437344 A1, 2004 ; Location in patent: Page 33 ; |
|
~9%
1-(2-hydroxy-5-... CAS#:88521-75-9 |
| Literature: Suzuki; Horaguchi; Shimizu; Abe Bulletin of the Chemical Society of Japan, 1983 , vol. 56, # 9 p. 2762 - 2767 |
| 2'-hydroxy-5'-nitroisobutyrophenone |