tert-Butyl (2-aminobenzyl)carbamate structure
|
Common Name | tert-Butyl (2-aminobenzyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 885270-83-7 | Molecular Weight | 222.283 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 320.5±25.0 °C at 760 mmHg | |
| Molecular Formula | C12H18N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 147.6±23.2 °C | |
| Name | tert-butyl N-(2-aminophenyl)-N-methylcarbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 320.5±25.0 °C at 760 mmHg |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.283 |
| Flash Point | 147.6±23.2 °C |
| Exact Mass | 222.136826 |
| PSA | 55.56000 |
| LogP | 2.09 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | QWLGWHNBBXMGRY-UHFFFAOYSA-N |
| SMILES | CN(C(=O)OC(C)(C)C)c1ccccc1N |
| HS Code | 2924299090 |
|---|
|
~32%
tert-Butyl (2-a... CAS#:885270-83-7 |
| Literature: Medarex, Inc. Patent: US2010/145036 A1, 2010 ; Location in patent: Page/Page column 54; 56 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| tert-Butyl (2-aminobenzyl)carbamate |
| 2-Methyl-2-propanyl (2-aminobenzyl)carbamate |
| 2-Methyl-2-propanyl (2-aminophenyl)methylcarbamate |
| Carbamic acid, N-(2-aminophenyl)-N-methyl-, 1,1-dimethylethyl ester |
| Carbamic acid, N-[(2-aminophenyl)methyl]-, 1,1-dimethylethyl ester |