8-Bromo-6-chloro-2H-chromene-3-carboxylic acid structure
|
Common Name | 8-Bromo-6-chloro-2H-chromene-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 885271-01-2 | Molecular Weight | 289.51000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H6BrClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-bromo-6-chloro-2h-chromene-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H6BrClO3 |
|---|---|
| Molecular Weight | 289.51000 |
| Exact Mass | 287.91900 |
| PSA | 46.53000 |
| LogP | 2.96290 |
| InChIKey | IHRUPOXHNYLUCC-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=Cc2cc(Cl)cc(Br)c2OC1 |
| HS Code | 2916190090 |
|---|
| HS Code | 2916190090 |
|---|---|
| Summary | 2916190090 unsaturated acyclic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2H-1-Benzopyran-3-carboxylicacid,8-bromo-6-chloro |