2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole
Modify Date: 2025-09-11 11:00:36
2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole structure
|
Common Name | 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole | ||
|---|---|---|---|---|
| CAS Number | 885271-09-0 | Molecular Weight | 268.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14BrNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14BrNO |
|---|---|
| Molecular Weight | 268.15 |
| InChIKey | HVCLJUVMOVVZBS-UHFFFAOYSA-N |
| SMILES | CC(C)C1COC(c2ccccc2Br)=N1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole? |
| A: The English name of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole is 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole. |
| Q: What is the molecular formula of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole? |
| A: Molecular formula of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole is C12H14BrNO. |
| Q: What is the CAS number of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole? |
| A: CAS number of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole is 885271-09-0. |
| Q: What is the SMILES notation of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole? |
| A: SMILES notation of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole is CC(C)C1COC(c2ccccc2Br)=N1. |
| Q: What is the Chinese name of 885271-09-0? |
| A: Chinese name of 885271-09-0 is 885271-09-0. |
| Q: What is the InChIKey of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole? |
| A: InChIKey of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole is HVCLJUVMOVVZBS-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole? |
| A: Molecular weight of 2-(2-Bromophenyl)-4-(propan-2-yl)-4,5-dihydro-1,3-oxazole is 268.15. |