3-(1H-Indazol-6-yl)propanoic acid
3-(1H-Indazol-6-yl)propanoic acid structure
|
Common Name | 3-(1H-Indazol-6-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 885271-23-8 | Molecular Weight | 190.199 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 433.7±20.0 °C at 760 mmHg | |
| Molecular Formula | C10H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.1±21.8 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(1H-Indazol-6-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 433.7±20.0 °C at 760 mmHg |
| Molecular Formula | C10H10N2O2 |
| Molecular Weight | 190.199 |
| Flash Point | 216.1±21.8 °C |
| Exact Mass | 190.074234 |
| PSA | 65.98000 |
| LogP | 1.44 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.677 |
| InChIKey | CVRGUMPECSUQDI-UHFFFAOYSA-N |
| SMILES | O=C(O)CCc1ccc2cn[nH]c2c1 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indazole-6-propanoicacid |
| 3-(1H-Indazol-6-yl)propanoic acid |
| 1H-Indazole-6-propanoic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: InChIKey of 3-(1H-Indazol-6-yl)propanoic acid is CVRGUMPECSUQDI-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: CAS number of 3-(1H-Indazol-6-yl)propanoic acid is 885271-23-8. |
| Q: What is the molecular weight of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: Molecular weight of 3-(1H-Indazol-6-yl)propanoic acid is 190.199. |
| Q: What is the molecular formula of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: Molecular formula of 3-(1H-Indazol-6-yl)propanoic acid is C10H10N2O2. |
| Q: What is the boiling point of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: Boiling point of 3-(1H-Indazol-6-yl)propanoic acid is 433.7±20.0 °C at 760 mmHg. |
| Q: What English synonyms does 3-(1H-Indazol-6-yl)propanoic acid have? |
| A: English synonyms of 3-(1H-Indazol-6-yl)propanoic acid: 1H-Indazole-6-propanoicacid, 3-(1H-Indazol-6-yl)propanoic acid, 1H-Indazole-6-propanoic acid. |
| Q: What is the LogP of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: LogP of 3-(1H-Indazol-6-yl)propanoic acid is 1.44. |
| Q: What is the polar surface area (PSA) of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: Polar surface area (PSA) of 3-(1H-Indazol-6-yl)propanoic acid is 65.98000. |
| Q: What is the English name of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: The English name of 3-(1H-Indazol-6-yl)propanoic acid is 3-(1H-Indazol-6-yl)propanoic acid. |
| Q: What is the SMILES notation of 3-(1H-Indazol-6-yl)propanoic acid? |
| A: SMILES notation of 3-(1H-Indazol-6-yl)propanoic acid is O=C(O)CCc1ccc2cn[nH]c2c1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |