Methyl 3-iodo-1H-indazole-5-carboxylate structure
|
Common Name | Methyl 3-iodo-1H-indazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 885271-25-0 | Molecular Weight | 302.069 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 421.4±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H7IN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.6±23.2 °C | |
| Name | Methyl 3-iodo-1H-indazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 421.4±25.0 °C at 760 mmHg |
| Molecular Formula | C9H7IN2O2 |
| Molecular Weight | 302.069 |
| Flash Point | 208.6±23.2 °C |
| Exact Mass | 301.955200 |
| PSA | 54.98000 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.721 |
| InChIKey | JQHYEHRKSDHNFC-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2n[nH]c(I)c2c1 |
| HS Code | 2933990090 |
|---|
|
~%
Methyl 3-iodo-1... CAS#:885271-25-0 |
| Literature: WO2006/86255 A2, ; Page/Page column 85; 86 ; WO 2006/086255 A2 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indazole-5-carboxylic acid, 3-iodo-, methyl ester |
| Methyl 3-iodo-1H-indazole-7-carboxylate |
| methyl 3-iodo-2H-indazole-5-carboxylate |
| Methyl 3-iodo-1H-indazole-5-carboxylate |
| 1H-Indazole-7-carboxylic acid, 3-iodo-, methyl ester |